Itrakonazol

Daripada Wikipedia, ensiklopedia bebas.
Jump to navigation Jump to search

{{drugbox | verifiedrevid = 459522522 | IUPAC_name = (2R,4S)-rel-1-(butan-2-il)-4-{4-[4-(4-{[(2R,4S)-2-(2,4-diklorofenil)-2-
(1H-1,2,4-triazol-1-ilmetil)-1,3-dioksolan-
4-yl]metoksi}fenil)piperazin-1-il]fenil}-4,5-dihidro-1H-1,2,4-triazol-5-on | image = Itraconazole2DACS.svg | width = 300px | imagename = Campuran 1 : 1 (rasemat) | drug_name = Itrakonazol

| tradename = Sporanox | Drugs.com = Monograph | MedlinePlus = a692049 | pregnancy_AU = B3 | pregnancy_US = C | legal_AU = S4 | legal_CA = Rx-sahaja | legal_UK = POM | legal_US = Rx-sahaja | routes_of_administration = Mulut dan i.v. (AS), Mulut sahaja (UK)

| bioavailability = 55%, maksimum sekiranya diambil dengan hidangan lengkap | protein_bound = 99.8% | metabolism = hepatik (CYP3A4) | elimination_half-life = 21 jam | excretion = Air kencing, tinja

| CASNo_Ref =  Yes check.svgY | CAS_number_Ref =  Yes check.svgY | CAS_number = 84625-61-6 | ATC_prefix = J02 | ATC_suffix = AC02 | PubChem = 55283 | DrugBank_Ref =  Yes check.svgY

| DrugBank = DB01167

| ChemSpiderID_Ref =  Yes check.svgY | ChemSpiderID = 49927 | UNII_Ref = Templat:Fdacite | UNII = 304NUG5GF4 | KEGG_Ref =  Yes check.svgY | KEGG = D00350 | ChEBI_Ref =  Yes check.svgY | ChEBI = 6076 | ChEMBL_Ref =  Yes check.svgY | ChEMBL = 22587

| C=35 | H=38 | Cl=2 | N=8 | O=4 | molecular_weight = 705.64 | smiles = O=C1N(/N=C\N1c2ccc(cc2)N7CCN(c6ccc(OC[C@@H]3O[C@](OC3)(c4ccc(Cl)cc4Cl)Cn5ncnc5)cc6)CC7)C(C)CC | InChI = 1/C35H38Cl2N8O4/c1-3-25(2)45-34(46)44(24-40-45)29-7-5-27(6-8-29)41-14-16-42(17-15-41)28-9-11-30(12-10-28)47-19-31-20-48-35(49-31,21-43-23-38-22-39-43)32-13-4-26(36)18-33(32)37/h4-13,18,22-25,31H,3,14-17,19-21H2,1-2H3/t25?,31-,35-/m0/s1 | InChIKey = VHVPQPYKVGDNFY-ZPGVKDDIBW | StdInChI_Ref =  Yes check.svgY | StdInChI = 1S/C35H38Cl2N8O4/c1-3-25(2)45-34(46)44(24-40-45)29-7-5-27(6-8-29)41-14-16-42(17-15-41)28-9-11-30(12-10-28)47-19-31-20-48-35(49-31,21-43-23-38-22-39-43)32-13-4-26(36)18-33(32)37/h4-13,18,22-25,31H,3,14-17,19-21H2,1-2H3/t25?,31-,35-/m0/s1 | StdInChIKey_Ref =  Yes check.svgY | StdInChIKey = VHVPQPYKVGDNFY-ZPGVKDDISA-N }} Itrakonazol (R51211), dicipta pada 1984, ialah agen antikulat triazola dipreskripsi kepada pesakit dengan jangkitan kulat. Ubat ini boleh diberikan melalui mulut atau melalui intravena.

Lihat juga[sunting | sunting sumber]

Nota kaki[sunting | sunting sumber]

Pautan luar[sunting | sunting sumber]

Templat:Antikulat Templat:Piperazina